C14H25N3O6S — CID 134198190
(2S)-2-[[(2R)-6-[(2-sulfanylacetyl)amino]hexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 134198190) has the molecular formula C14H25N3O6S and a molecular weight of 363.44 g/mol. Its IUPAC name is (2S)-2-[[(2R)-6-[(2-sulfanylacetyl)amino]hexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2R)-6-[(2-sulfanylacetyl)amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 134198190 |
| Molecular Formula | C14H25N3O6S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2S)-2-[[(2R)-6-[(2-sulfanylacetyl)amino]hexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | C[C@H](CCCCNC(=O)CS)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N3O6S/c1-9(4-2-3-7-15-11(18)8-24)16-14(23)17-10(13(21)22)5-6-12(19)20/h9-10,24H,2-8H2,1H3,(H,15,18)(H,19,20)(H,21,22)(H2,16,17,23)/t9-,10+/m1/s1 |
| InChIKey | JFKMGRHITVMTHK-ZJUUUORDSA-N |
| XLogP | 0.21 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|