About 6-oxohept-2-enal
6-oxohept-2-enal (PubChem CID 57259374) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 6-oxohept-2-enal.
Molecular Properties
| Compound Name | 6-oxohept-2-enal |
| PubChem CID | 57259374 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 6-oxohept-2-enal |
| SMILES | CC(=O)CCC=CC=O |
| InChI | InChI=1S/C7H10O2/c1-7(9)5-3-2-4-6-8/h2,4,6H,3,5H2,1H3 |
| InChIKey | OPUWJQUPRWWZSZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-oxohept-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxohept-2-enal?
The IUPAC name of 6-oxohept-2-enal (CID 57259374) is 6-oxohept-2-enal.
What is the SMILES notation for 6-oxohept-2-enal?
The canonical SMILES for 6-oxohept-2-enal is CC(=O)CCC=CC=O.
What is the InChIKey of 6-oxohept-2-enal?
The InChIKey is OPUWJQUPRWWZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-7(9)5-3-2-4-6-8/h2,4,6H,3,5H2,1H3.
What are the key properties of 6-oxohept-2-enal?
6-oxohept-2-enal has a molecular weight of 126.15 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxohept-2-enal is sourced from PubChem (CID 57259374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).