C14H22O2 — CID 135026135
ethyl (8E,10E)-dodeca-6,8,10-trienoate (PubChem CID 135026135) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethyl (8E,10E)-dodeca-6,8,10-trienoate.
| Compound Name | ethyl (8E,10E)-dodeca-6,8,10-trienoate |
|---|---|
| PubChem CID | 135026135 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethyl (8E,10E)-dodeca-6,8,10-trienoate |
| SMILES | C/C=C/C=C/C=CCCCCC(=O)OCC |
| InChI | InChI=1S/C14H22O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2/h3,5-9H,4,10-13H2,1-2H3/b5-3+,7-6+,9-8? |
| InChIKey | MEFBBICEZGACJN-MBMPWVHXSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|