C12H19Br — CID 101195298
(4Z)-4-(2-bromoethylidene)-8-methylnona-1,7-diene (PubChem CID 101195298) has the molecular formula C12H19Br and a molecular weight of 243.19 g/mol. Its IUPAC name is (4Z)-4-(2-bromoethylidene)-8-methylnona-1,7-diene.
| Compound Name | (4Z)-4-(2-bromoethylidene)-8-methylnona-1,7-diene |
|---|---|
| PubChem CID | 101195298 |
| Molecular Formula | C12H19Br |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (4Z)-4-(2-bromoethylidene)-8-methylnona-1,7-diene |
| SMILES | C=CC/C(=C\CBr)CCC=C(C)C |
| InChI | InChI=1S/C12H19Br/c1-4-6-12(9-10-13)8-5-7-11(2)3/h4,7,9H,1,5-6,8,10H2,2-3H3/b12-9+ |
| InChIKey | IIMHCNXJFGOYMY-FMIVXFBMSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|