C11H22ClN — CID 174502351
(E)-4-(chloromethyl)-N,N-dimethyloct-4-en-2-amine (PubChem CID 174502351) has the molecular formula C11H22ClN and a molecular weight of 203.76 g/mol. Its IUPAC name is (E)-4-(chloromethyl)-N,N-dimethyloct-4-en-2-amine.
| Compound Name | (E)-4-(chloromethyl)-N,N-dimethyloct-4-en-2-amine |
|---|---|
| PubChem CID | 174502351 |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.76 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (E)-4-(chloromethyl)-N,N-dimethyloct-4-en-2-amine |
| SMILES | CCC/C=C(/CCl)CC(C)N(C)C |
| InChI | InChI=1S/C11H22ClN/c1-5-6-7-11(9-12)8-10(2)13(3)4/h7,10H,5-6,8-9H2,1-4H3/b11-7+ |
| InChIKey | QKCAPQFLAXTSLS-YRNVUSSQSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.76 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|