C13H23I — CID 11515038
(2E,4R,6E)-6-ethyl-2-iodo-4-methyldeca-2,6-diene (PubChem CID 11515038) has the molecular formula C13H23I and a molecular weight of 306.23 g/mol. Its IUPAC name is (2E,4R,6E)-6-ethyl-2-iodo-4-methyldeca-2,6-diene.
| Compound Name | (2E,4R,6E)-6-ethyl-2-iodo-4-methyldeca-2,6-diene |
|---|---|
| PubChem CID | 11515038 |
| Molecular Formula | C13H23I |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (2E,4R,6E)-6-ethyl-2-iodo-4-methyldeca-2,6-diene |
| SMILES | CCC/C=C(\CC)C[C@@H](C)/C=C(\C)I |
| InChI | InChI=1S/C13H23I/c1-5-7-8-13(6-2)10-11(3)9-12(4)14/h8-9,11H,5-7,10H2,1-4H3/b12-9+,13-8+/t11-/m0/s1 |
| InChIKey | XMYAUVHCZYFJKC-HOOLAPQPSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|