About 4-ethyl-6-methyldeca-3,7-diene
4-ethyl-6-methyldeca-3,7-diene (PubChem CID 161475233) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 4-ethyl-6-methyldeca-3,7-diene.
Molecular Properties
| Compound Name | 4-ethyl-6-methyldeca-3,7-diene |
| PubChem CID | 161475233 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 4-ethyl-6-methyldeca-3,7-diene |
| SMILES | CCC=CC(C)CC(=CCC)CC |
| InChI | InChI=1S/C13H24/c1-5-8-10-12(4)11-13(7-3)9-6-2/h8-10,12H,5-7,11H2,1-4H3 |
| InChIKey | FYNWDEJNOSRIKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-6-methyldeca-3,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-methyldeca-3,7-diene?
The IUPAC name of 4-ethyl-6-methyldeca-3,7-diene (CID 161475233) is 4-ethyl-6-methyldeca-3,7-diene.
What is the SMILES notation for 4-ethyl-6-methyldeca-3,7-diene?
The canonical SMILES for 4-ethyl-6-methyldeca-3,7-diene is CCC=CC(C)CC(=CCC)CC.
What is the InChIKey of 4-ethyl-6-methyldeca-3,7-diene?
The InChIKey is FYNWDEJNOSRIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-5-8-10-12(4)11-13(7-3)9-6-2/h8-10,12H,5-7,11H2,1-4H3.
What are the key properties of 4-ethyl-6-methyldeca-3,7-diene?
4-ethyl-6-methyldeca-3,7-diene has a molecular weight of 180.33 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-methyldeca-3,7-diene is sourced from PubChem (CID 161475233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).