About (E)-3-methylhept-4-enoyl chloride
(E)-3-methylhept-4-enoyl chloride (PubChem CID 19936104) has the molecular formula C8H13ClO
and a molecular weight of 160.64 g/mol. Its IUPAC name is (E)-3-methylhept-4-enoyl chloride.
Molecular Properties
| Compound Name | (E)-3-methylhept-4-enoyl chloride |
| PubChem CID | 19936104 |
| Molecular Formula | C8H13ClO |
| Molecular Weight | 160.64 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (E)-3-methylhept-4-enoyl chloride |
| SMILES | CC/C=C/C(C)CC(=O)Cl |
| InChI | InChI=1S/C8H13ClO/c1-3-4-5-7(2)6-8(9)10/h4-5,7H,3,6H2,1-2H3/b5-4+ |
| InChIKey | YSRAVXKNZMGSJU-SNAWJCMRSA-N |
| XLogP | 2.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methylhept-4-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methylhept-4-enoyl chloride?
The IUPAC name of (E)-3-methylhept-4-enoyl chloride (CID 19936104) is (E)-3-methylhept-4-enoyl chloride.
What is the SMILES notation for (E)-3-methylhept-4-enoyl chloride?
The canonical SMILES for (E)-3-methylhept-4-enoyl chloride is CC/C=C/C(C)CC(=O)Cl.
What is the InChIKey of (E)-3-methylhept-4-enoyl chloride?
The InChIKey is YSRAVXKNZMGSJU-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H13ClO/c1-3-4-5-7(2)6-8(9)10/h4-5,7H,3,6H2,1-2H3/b5-4+.
What are the key properties of (E)-3-methylhept-4-enoyl chloride?
(E)-3-methylhept-4-enoyl chloride has a molecular weight of 160.64 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methylhept-4-enoyl chloride is sourced from PubChem (CID 19936104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).