C8H15NO — CID 134947978
N-[(E,2S)-hex-3-en-2-yl]acetamide (PubChem CID 134947978) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is N-[(E,2S)-hex-3-en-2-yl]acetamide.
| Compound Name | N-[(E,2S)-hex-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 134947978 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-[(E,2S)-hex-3-en-2-yl]acetamide |
| SMILES | CC/C=C/[C@H](C)NC(C)=O |
| InChI | InChI=1S/C8H15NO/c1-4-5-6-7(2)9-8(3)10/h5-7H,4H2,1-3H3,(H,9,10)/b6-5+/t7-/m0/s1 |
| InChIKey | GLHBYQKOEFOACZ-XPPMVYLVSA-N |
| XLogP | 1.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|