C13H21NO3 — CID 11947884
(2Z,4R,5S,6E)-3-acetamido-4,5-dimethylnona-2,6-dienoic acid (PubChem CID 11947884) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (2Z,4R,5S,6E)-3-acetamido-4,5-dimethylnona-2,6-dienoic acid.
| Compound Name | (2Z,4R,5S,6E)-3-acetamido-4,5-dimethylnona-2,6-dienoic acid |
|---|---|
| PubChem CID | 11947884 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (2Z,4R,5S,6E)-3-acetamido-4,5-dimethylnona-2,6-dienoic acid |
| SMILES | CC/C=C/[C@H](C)[C@@H](C)/C(=C/C(=O)O)NC(C)=O |
| InChI | InChI=1S/C13H21NO3/c1-5-6-7-9(2)10(3)12(8-13(16)17)14-11(4)15/h6-10H,5H2,1-4H3,(H,14,15)(H,16,17)/b7-6+,12-8-/t9-,10+/m0/s1 |
| InChIKey | TZMZUIBVKFLTMU-KSDZOIADSA-N |
| XLogP | 2.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|