C11H20O2 — CID 87090108
(Z)-2,3-dimethylnon-4-enoic acid (PubChem CID 87090108) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (Z)-2,3-dimethylnon-4-enoic acid.
| Compound Name | (Z)-2,3-dimethylnon-4-enoic acid |
|---|---|
| PubChem CID | 87090108 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (Z)-2,3-dimethylnon-4-enoic acid |
| SMILES | CCCC/C=C\C(C)C(C)C(=O)O |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-9(2)10(3)11(12)13/h7-10H,4-6H2,1-3H3,(H,12,13)/b8-7- |
| InChIKey | ZAHLYNYJUJNNSR-FPLPWBNLSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|