C12H21ClO2 — CID 14486227
(2E,6Z)-6-(chloromethyl)-1,8-dimethoxy-2-methylocta-2,6-diene (PubChem CID 14486227) has the molecular formula C12H21ClO2 and a molecular weight of 232.75 g/mol. Its IUPAC name is (2E,6Z)-6-(chloromethyl)-1,8-dimethoxy-2-methylocta-2,6-diene.
| Compound Name | (2E,6Z)-6-(chloromethyl)-1,8-dimethoxy-2-methylocta-2,6-diene |
|---|---|
| PubChem CID | 14486227 |
| Molecular Formula | C12H21ClO2 |
| Molecular Weight | 232.75 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2E,6Z)-6-(chloromethyl)-1,8-dimethoxy-2-methylocta-2,6-diene |
| SMILES | COC/C=C(\CCl)CC/C=C(\C)COC |
| InChI | InChI=1S/C12H21ClO2/c1-11(10-15-3)5-4-6-12(9-13)7-8-14-2/h5,7H,4,6,8-10H2,1-3H3/b11-5+,12-7- |
| InChIKey | UOKXUTJQWNDORS-DEYHNVIJSA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|