C17H25O — CID 177444269
CID 177444269 (PubChem CID 177444269) has the molecular formula C17H25O and a molecular weight of 245.39 g/mol.
| Compound Name | CID 177444269 |
|---|---|
| PubChem CID | 177444269 |
| Molecular Formula | C17H25O |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | — |
| SMILES | [CH2]/C(C)=C\CC/C(C)=C/CC/C(C)=C/C(=O)C=C |
| InChI | InChI=1S/C17H25O/c1-6-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h6,9,11,13H,1-2,7-8,10,12H2,3-5H3/b14-9+,15-11+,16-13+ |
| InChIKey | RUFUGSQQGJXMBH-HXMFGCACSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|