C14H22O — CID 54454363
3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-ol (PubChem CID 54454363) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-ol.
| Compound Name | 3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-ol |
|---|---|
| PubChem CID | 54454363 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 3,7-dimethyl-4-prop-1-en-2-ylnona-1,6,8-trien-3-ol |
| SMILES | C=CC(C)=CCC(C(=C)C)C(C)(O)C=C |
| InChI | InChI=1S/C14H22O/c1-7-12(5)9-10-13(11(3)4)14(6,15)8-2/h7-9,13,15H,1-3,10H2,4-6H3 |
| InChIKey | WXDGUFZLJUPGFM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|