C15H26O — CID 161073978
hepta-1,6-diene;2-methylhepta-1,6-dien-3-ol (PubChem CID 161073978) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is hepta-1,6-diene;2-methylhepta-1,6-dien-3-ol.
| Compound Name | hepta-1,6-diene;2-methylhepta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 161073978 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | hepta-1,6-diene;2-methylhepta-1,6-dien-3-ol |
| SMILES | C=CCCC(O)C(=C)C.C=CCCCC=C |
| InChI | InChI=1S/C8H14O.C7H12/c1-4-5-6-8(9)7(2)3;1-3-5-7-6-4-2/h4,8-9H,1-2,5-6H2,3H3;3-4H,1-2,5-7H2 |
| InChIKey | UFAFTOJVUOYGKN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|