C18H24O2 — CID 162952972
4-[(3S,6R)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol (PubChem CID 162952972) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[(3S,6R)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol.
| Compound Name | 4-[(3S,6R)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol |
|---|---|
| PubChem CID | 162952972 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-[(3S,6R)-3-ethenyl-6-hydroxy-3,7-dimethylocta-1,7-dienyl]phenol |
| SMILES | C=C[C@@](C)(C=Cc1ccc(O)cc1)CC[C@@H](O)C(=C)C |
| InChI | InChI=1S/C18H24O2/c1-5-18(4,13-11-17(20)14(2)3)12-10-15-6-8-16(19)9-7-15/h5-10,12,17,19-20H,1-2,11,13H2,3-4H3/t17-,18+/m1/s1 |
| InChIKey | GWTVXRIOJRNDCM-MSOLQXFVSA-N |
| XLogP | 4.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|