C20H32O3 — CID 87809703
9-methyl-12-propan-2-ylhexadeca-8,10-diene-2,6,15-trione (PubChem CID 87809703) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 9-methyl-12-propan-2-ylhexadeca-8,10-diene-2,6,15-trione.
| Compound Name | 9-methyl-12-propan-2-ylhexadeca-8,10-diene-2,6,15-trione |
|---|---|
| PubChem CID | 87809703 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 9-methyl-12-propan-2-ylhexadeca-8,10-diene-2,6,15-trione |
| SMILES | CC(=O)CCCC(=O)CC=C(C)C=CC(CCC(C)=O)C(C)C |
| InChI | InChI=1S/C20H32O3/c1-15(2)19(13-11-18(5)22)12-9-16(3)10-14-20(23)8-6-7-17(4)21/h9-10,12,15,19H,6-8,11,13-14H2,1-5H3 |
| InChIKey | HVPPONJWZFYBTQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|