C8H16N2 — CID 166682771
(3Z)-octa-1,3-diene-2,5-diamine (PubChem CID 166682771) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (3Z)-octa-1,3-diene-2,5-diamine.
| Compound Name | (3Z)-octa-1,3-diene-2,5-diamine |
|---|---|
| PubChem CID | 166682771 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (3Z)-octa-1,3-diene-2,5-diamine |
| SMILES | C=C(N)/C=C\C(N)CCC |
| InChI | InChI=1S/C8H16N2/c1-3-4-8(10)6-5-7(2)9/h5-6,8H,2-4,9-10H2,1H3/b6-5- |
| InChIKey | SVUZGDGCVAIDKM-WAYWQWQTSA-N |
| XLogP | 1.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|