C7H13NO — CID 147712752
(3Z)-5-aminohepta-1,3-dien-2-ol (PubChem CID 147712752) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (3Z)-5-aminohepta-1,3-dien-2-ol.
| Compound Name | (3Z)-5-aminohepta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 147712752 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3Z)-5-aminohepta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\C(N)CC |
| InChI | InChI=1S/C7H13NO/c1-3-7(8)5-4-6(2)9/h4-5,7,9H,2-3,8H2,1H3/b5-4- |
| InChIKey | GVAOKJOXYKVZRE-PLNGDYQASA-N |
| XLogP | 1.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|