C7H14F2N2 — CID 54131887
1,1-difluorohept-3-ene-2,5-diamine (PubChem CID 54131887) has the molecular formula C7H14F2N2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,1-difluorohept-3-ene-2,5-diamine.
| Compound Name | 1,1-difluorohept-3-ene-2,5-diamine |
|---|---|
| PubChem CID | 54131887 |
| Molecular Formula | C7H14F2N2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1,1-difluorohept-3-ene-2,5-diamine |
| SMILES | CCC(N)C=CC(N)C(F)F |
| InChI | InChI=1S/C7H14F2N2/c1-2-5(10)3-4-6(11)7(8)9/h3-7H,2,10-11H2,1H3 |
| InChIKey | NUYITAUNROHAMF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|