C10H22N2 — CID 101163776
(Z,3S,6S)-2,7-dimethyloct-4-ene-3,6-diamine (PubChem CID 101163776) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (Z,3S,6S)-2,7-dimethyloct-4-ene-3,6-diamine.
| Compound Name | (Z,3S,6S)-2,7-dimethyloct-4-ene-3,6-diamine |
|---|---|
| PubChem CID | 101163776 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (Z,3S,6S)-2,7-dimethyloct-4-ene-3,6-diamine |
| SMILES | CC(C)[C@H](N)/C=C\[C@@H](N)C(C)C |
| InChI | InChI=1S/C10H22N2/c1-7(2)9(11)5-6-10(12)8(3)4/h5-10H,11-12H2,1-4H3/b6-5-/t9-,10-/m1/s1 |
| InChIKey | ILXUTXODYRYRCZ-KWMOZEJZSA-N |
| XLogP | 1.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|