C12H22N2 — CID 100988529
(5E)-3,8-dimethyldeca-1,5,9-triene-4,7-diamine (PubChem CID 100988529) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (5E)-3,8-dimethyldeca-1,5,9-triene-4,7-diamine.
| Compound Name | (5E)-3,8-dimethyldeca-1,5,9-triene-4,7-diamine |
|---|---|
| PubChem CID | 100988529 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (5E)-3,8-dimethyldeca-1,5,9-triene-4,7-diamine |
| SMILES | C=CC(C)C(N)/C=C/C(N)C(C)C=C |
| InChI | InChI=1S/C12H22N2/c1-5-9(3)11(13)7-8-12(14)10(4)6-2/h5-12H,1-2,13-14H2,3-4H3/b8-7+ |
| InChIKey | YVHHGNNOJHMCBE-BQYQJAHWSA-N |
| XLogP | 1.84 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|