About 5-ethylhept-4-en-3-amine;hydrochloride
5-ethylhept-4-en-3-amine;hydrochloride (PubChem CID 173326554) has the molecular formula C9H20ClN
and a molecular weight of 177.72 g/mol. Its IUPAC name is 5-ethylhept-4-en-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-ethylhept-4-en-3-amine;hydrochloride |
| PubChem CID | 173326554 |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5-ethylhept-4-en-3-amine;hydrochloride |
| SMILES | CCC(=CC(N)CC)CC.Cl |
| InChI | InChI=1S/C9H19N.ClH/c1-4-8(5-2)7-9(10)6-3;/h7,9H,4-6,10H2,1-3H3;1H |
| InChIKey | ZBDONSMEPFFYDX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylhept-4-en-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylhept-4-en-3-amine;hydrochloride?
The IUPAC name of 5-ethylhept-4-en-3-amine;hydrochloride (CID 173326554) is 5-ethylhept-4-en-3-amine;hydrochloride.
What is the SMILES notation for 5-ethylhept-4-en-3-amine;hydrochloride?
The canonical SMILES for 5-ethylhept-4-en-3-amine;hydrochloride is CCC(=CC(N)CC)CC.Cl.
What is the InChIKey of 5-ethylhept-4-en-3-amine;hydrochloride?
The InChIKey is ZBDONSMEPFFYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.ClH/c1-4-8(5-2)7-9(10)6-3;/h7,9H,4-6,10H2,1-3H3;1H.
What are the key properties of 5-ethylhept-4-en-3-amine;hydrochloride?
5-ethylhept-4-en-3-amine;hydrochloride has a molecular weight of 177.72 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylhept-4-en-3-amine;hydrochloride is sourced from PubChem (CID 173326554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).