About (E)-7-aminohept-2-en-4-ol;azane
(E)-7-aminohept-2-en-4-ol;azane (PubChem CID 87834016) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is (E)-7-aminohept-2-en-4-ol;azane.
Molecular Properties
| Compound Name | (E)-7-aminohept-2-en-4-ol;azane |
| PubChem CID | 87834016 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | (E)-7-aminohept-2-en-4-ol;azane |
| SMILES | C/C=C/C(O)CCCN.N |
| InChI | InChI=1S/C7H15NO.H3N/c1-2-4-7(9)5-3-6-8;/h2,4,7,9H,3,5-6,8H2,1H3;1H3/b4-2+; |
| InChIKey | QUCQHKPNFZBIEW-VEELZWTKSA-N |
| XLogP | 0.82 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-aminohept-2-en-4-ol;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-aminohept-2-en-4-ol;azane?
The IUPAC name of (E)-7-aminohept-2-en-4-ol;azane (CID 87834016) is (E)-7-aminohept-2-en-4-ol;azane.
What is the SMILES notation for (E)-7-aminohept-2-en-4-ol;azane?
The canonical SMILES for (E)-7-aminohept-2-en-4-ol;azane is C/C=C/C(O)CCCN.N.
What is the InChIKey of (E)-7-aminohept-2-en-4-ol;azane?
The InChIKey is QUCQHKPNFZBIEW-VEELZWTKSA-N. The full InChI is InChI=1S/C7H15NO.H3N/c1-2-4-7(9)5-3-6-8;/h2,4,7,9H,3,5-6,8H2,1H3;1H3/b4-2+;.
What are the key properties of (E)-7-aminohept-2-en-4-ol;azane?
(E)-7-aminohept-2-en-4-ol;azane has a molecular weight of 146.23 g/mol, XLogP of 0.82, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-aminohept-2-en-4-ol;azane is sourced from PubChem (CID 87834016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).