C10H22N2 — CID 130322819
6-methylnon-7-ene-1,5-diamine (PubChem CID 130322819) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 6-methylnon-7-ene-1,5-diamine.
| Compound Name | 6-methylnon-7-ene-1,5-diamine |
|---|---|
| PubChem CID | 130322819 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 6-methylnon-7-ene-1,5-diamine |
| SMILES | CC=CC(C)C(N)CCCCN |
| InChI | InChI=1S/C10H22N2/c1-3-6-9(2)10(12)7-4-5-8-11/h3,6,9-10H,4-5,7-8,11-12H2,1-2H3 |
| InChIKey | FALLXNMMLCMWID-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|