About (E)-4-chloroundec-2-ene
(E)-4-chloroundec-2-ene (PubChem CID 88753287) has the molecular formula C11H21Cl
and a molecular weight of 188.74 g/mol. Its IUPAC name is (E)-4-chloroundec-2-ene.
Molecular Properties
| Compound Name | (E)-4-chloroundec-2-ene |
| PubChem CID | 88753287 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (E)-4-chloroundec-2-ene |
| SMILES | C/C=C/C(Cl)CCCCCCC |
| InChI | InChI=1S/C11H21Cl/c1-3-5-6-7-8-10-11(12)9-4-2/h4,9,11H,3,5-8,10H2,1-2H3/b9-4+ |
| InChIKey | VQXBBKLCFQKWST-RUDMXATFSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-chloroundec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-chloroundec-2-ene?
The IUPAC name of (E)-4-chloroundec-2-ene (CID 88753287) is (E)-4-chloroundec-2-ene.
What is the SMILES notation for (E)-4-chloroundec-2-ene?
The canonical SMILES for (E)-4-chloroundec-2-ene is C/C=C/C(Cl)CCCCCCC.
What is the InChIKey of (E)-4-chloroundec-2-ene?
The InChIKey is VQXBBKLCFQKWST-RUDMXATFSA-N. The full InChI is InChI=1S/C11H21Cl/c1-3-5-6-7-8-10-11(12)9-4-2/h4,9,11H,3,5-8,10H2,1-2H3/b9-4+.
What are the key properties of (E)-4-chloroundec-2-ene?
(E)-4-chloroundec-2-ene has a molecular weight of 188.74 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-chloroundec-2-ene is sourced from PubChem (CID 88753287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).