C10H23ClN2 — CID 57473325
1-chloro-N,N,N',N'-tetraethylethane-1,2-diamine (PubChem CID 57473325) has the molecular formula C10H23ClN2 and a molecular weight of 206.76 g/mol. Its IUPAC name is 1-chloro-N,N,N',N'-tetraethylethane-1,2-diamine.
| Compound Name | 1-chloro-N,N,N',N'-tetraethylethane-1,2-diamine |
|---|---|
| PubChem CID | 57473325 |
| Molecular Formula | C10H23ClN2 |
| Molecular Weight | 206.76 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-chloro-N,N,N',N'-tetraethylethane-1,2-diamine |
| SMILES | CCN(CC)CC(Cl)N(CC)CC |
| InChI | InChI=1S/C10H23ClN2/c1-5-12(6-2)9-10(11)13(7-3)8-4/h10H,5-9H2,1-4H3 |
| InChIKey | SNWUBOVMROWMQQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|