C13H29BrN2 — CID 65010680
N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-propylethane-1,2-diamine (PubChem CID 65010680) has the molecular formula C13H29BrN2 and a molecular weight of 293.29 g/mol. Its IUPAC name is N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-propylethane-1,2-diamine.
| Compound Name | N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 65010680 |
| Molecular Formula | C13H29BrN2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-propylethane-1,2-diamine |
| SMILES | CCCC(CBr)CN(CCC)CCN(C)C |
| InChI | InChI=1S/C13H29BrN2/c1-5-7-13(11-14)12-16(8-6-2)10-9-15(3)4/h13H,5-12H2,1-4H3 |
| InChIKey | OVZWRTMJUDBCKT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|