About N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine
N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 65011420) has the molecular formula C14H31BrN2
and a molecular weight of 307.32 g/mol. Its IUPAC name is N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| PubChem CID | 65011420 |
| Molecular Formula | C14H31BrN2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CCCC(CBr)CN(CCN(C)C)CC(C)C |
| InChI | InChI=1S/C14H31BrN2/c1-6-7-14(10-15)12-17(11-13(2)3)9-8-16(4)5/h13-14H,6-12H2,1-5H3 |
| InChIKey | ZSSGDIOIRLIJRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The IUPAC name of N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (CID 65011420) is N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
What is the SMILES notation for N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The canonical SMILES for N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine is CCCC(CBr)CN(CCN(C)C)CC(C)C.
What is the InChIKey of N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The InChIKey is ZSSGDIOIRLIJRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31BrN2/c1-6-7-14(10-15)12-17(11-13(2)3)9-8-16(4)5/h13-14H,6-12H2,1-5H3.
What are the key properties of N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine?
N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine has a molecular weight of 307.32 g/mol, XLogP of 3.32, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(bromomethyl)pentyl]-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine is sourced from PubChem (CID 65011420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).