C11H22F3NO3 — CID 107481342
2-[3,3-diethoxypropyl(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107481342) has the molecular formula C11H22F3NO3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[3,3-diethoxypropyl(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[3,3-diethoxypropyl(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107481342 |
| Molecular Formula | C11H22F3NO3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-[3,3-diethoxypropyl(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CCOC(CCN(CCO)CC(F)(F)F)OCC |
| InChI | InChI=1S/C11H22F3NO3/c1-3-17-10(18-4-2)5-6-15(7-8-16)9-11(12,13)14/h10,16H,3-9H2,1-2H3 |
| InChIKey | VGLJNFRGDCSARY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|