C11H21BrF3NO — CID 107484736
2-[[2-(bromomethyl)-2-ethylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107484736) has the molecular formula C11H21BrF3NO and a molecular weight of 320.19 g/mol. Its IUPAC name is 2-[[2-(bromomethyl)-2-ethylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[[2-(bromomethyl)-2-ethylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107484736 |
| Molecular Formula | C11H21BrF3NO |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-[[2-(bromomethyl)-2-ethylbutyl]-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CCC(CC)(CBr)CN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H21BrF3NO/c1-3-10(4-2,7-12)8-16(5-6-17)9-11(13,14)15/h17H,3-9H2,1-2H3 |
| InChIKey | QQRKQQKSWFTNCL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|