C8H14F6N2 — CID 162601173
1-N,1-N-bis(2,2,2-trifluoroethyl)butane-1,3-diamine (PubChem CID 162601173) has the molecular formula C8H14F6N2 and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-N,1-N-bis(2,2,2-trifluoroethyl)butane-1,3-diamine.
| Compound Name | 1-N,1-N-bis(2,2,2-trifluoroethyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 162601173 |
| Molecular Formula | C8H14F6N2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-N,1-N-bis(2,2,2-trifluoroethyl)butane-1,3-diamine |
| SMILES | CC(N)CCN(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C8H14F6N2/c1-6(15)2-3-16(4-7(9,10)11)5-8(12,13)14/h6H,2-5,15H2,1H3 |
| InChIKey | CUWCHKHWNYDZJI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |