C17H37NO2 — CID 163532667
N-(3-ethoxy-3-methoxypropyl)-N,5-diethylheptan-1-amine (PubChem CID 163532667) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is N-(3-ethoxy-3-methoxypropyl)-N,5-diethylheptan-1-amine.
| Compound Name | N-(3-ethoxy-3-methoxypropyl)-N,5-diethylheptan-1-amine |
|---|---|
| PubChem CID | 163532667 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | N-(3-ethoxy-3-methoxypropyl)-N,5-diethylheptan-1-amine |
| SMILES | CCOC(CCN(CC)CCCCC(CC)CC)OC |
| InChI | InChI=1S/C17H37NO2/c1-6-16(7-2)12-10-11-14-18(8-3)15-13-17(19-5)20-9-4/h16-17H,6-15H2,1-5H3 |
| InChIKey | DUICNICBCNXTJL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|