methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate

C13H27NO4 — CID 81090824

IUPACmethyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate
SMILESCCOC(CCN(CC)CCC(=O)OC)OCC
InChIInChI=1S/C13H27NO4/c1-5-14(10-8-12(15)16-4)11-9-13(17-6-2)18-7-3/h13H,5-11H2,1-4H3
InChIKeyOSCAIYKTWKISHU-UHFFFAOYSA-N
MW261.36 g/mol
LogP1.66
Rot. Bonds11

About methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate

methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate (PubChem CID 81090824) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate
PubChem CID81090824
Molecular FormulaC13H27NO4
Molecular Weight261.36 g/mol
Exact Mass261.19
IUPAC Namemethyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate
SMILESCCOC(CCN(CC)CCC(=O)OC)OCC
InChIInChI=1S/C13H27NO4/c1-5-14(10-8-12(15)16-4)11-9-13(17-6-2)18-7-3/h13H,5-11H2,1-4H3
InChIKeyOSCAIYKTWKISHU-UHFFFAOYSA-N
XLogP1.66
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds11
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.36
LogP ≤ 51.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate?
The IUPAC name of methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate (CID 81090824) is methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate?
The canonical SMILES for methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate is CCOC(CCN(CC)CCC(=O)OC)OCC.
What is the InChIKey of methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate?
The InChIKey is OSCAIYKTWKISHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO4/c1-5-14(10-8-12(15)16-4)11-9-13(17-6-2)18-7-3/h13H,5-11H2,1-4H3.
What are the key properties of methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate?
methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate has a molecular weight of 261.36 g/mol, XLogP of 1.66, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate is sourced from PubChem (CID 81090824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).