C13H27NO4 — CID 81090824
methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate (PubChem CID 81090824) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate.
| Compound Name | methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate |
|---|---|
| PubChem CID | 81090824 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | methyl 3-[3,3-diethoxypropyl(ethyl)amino]propanoate |
| SMILES | CCOC(CCN(CC)CCC(=O)OC)OCC |
| InChI | InChI=1S/C13H27NO4/c1-5-14(10-8-12(15)16-4)11-9-13(17-6-2)18-7-3/h13H,5-11H2,1-4H3 |
| InChIKey | OSCAIYKTWKISHU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|