C12H28N2 — CID 81079998
N'-butyl-N',2-diethylbutane-1,4-diamine (PubChem CID 81079998) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N'-butyl-N',2-diethylbutane-1,4-diamine.
| Compound Name | N'-butyl-N',2-diethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 81079998 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N'-butyl-N',2-diethylbutane-1,4-diamine |
| SMILES | CCCCN(CC)CCC(CC)CN |
| InChI | InChI=1S/C12H28N2/c1-4-7-9-14(6-3)10-8-12(5-2)11-13/h12H,4-11,13H2,1-3H3 |
| InChIKey | ISDJOUBLVVZAGP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |