C14H32N2 — CID 81080597
N'-butan-2-yl-N'-butyl-2-ethylbutane-1,4-diamine (PubChem CID 81080597) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is N'-butan-2-yl-N'-butyl-2-ethylbutane-1,4-diamine.
| Compound Name | N'-butan-2-yl-N'-butyl-2-ethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 81080597 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | N'-butan-2-yl-N'-butyl-2-ethylbutane-1,4-diamine |
| SMILES | CCCCN(CCC(CC)CN)C(C)CC |
| InChI | InChI=1S/C14H32N2/c1-5-8-10-16(13(4)6-2)11-9-14(7-3)12-15/h13-14H,5-12,15H2,1-4H3 |
| InChIKey | FVIXYMGFWAYJJU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |