C13H31NO — CID 172857272
N,N-dibutylpentan-2-amine;hydrate (PubChem CID 172857272) has the molecular formula C13H31NO and a molecular weight of 217.40 g/mol. Its IUPAC name is N,N-dibutylpentan-2-amine;hydrate.
| Compound Name | N,N-dibutylpentan-2-amine;hydrate |
|---|---|
| PubChem CID | 172857272 |
| Molecular Formula | C13H31NO |
| Molecular Weight | 217.40 g/mol |
| Exact Mass | 217.24 |
| IUPAC Name | N,N-dibutylpentan-2-amine;hydrate |
| SMILES | CCCCN(CCCC)C(C)CCC.O |
| InChI | InChI=1S/C13H29N.H2O/c1-5-8-11-14(12-9-6-2)13(4)10-7-3;/h13H,5-12H2,1-4H3;1H2 |
| InChIKey | YWNYLBOMUPRSPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |