C14H31N — CID 124633708
(2S)-N,N-dibutylhexan-2-amine (PubChem CID 124633708) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is (2S)-N,N-dibutylhexan-2-amine.
| Compound Name | (2S)-N,N-dibutylhexan-2-amine |
|---|---|
| PubChem CID | 124633708 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | (2S)-N,N-dibutylhexan-2-amine |
| SMILES | CCCC[C@H](C)N(CCCC)CCCC |
| InChI | InChI=1S/C14H31N/c1-5-8-11-14(4)15(12-9-6-2)13-10-7-3/h14H,5-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | WMJSFJJSJHUGOW-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |