About 4-N,4-N-dibutylpentane-2,4-diamine
4-N,4-N-dibutylpentane-2,4-diamine (PubChem CID 64708414) has the molecular formula C13H30N2
and a molecular weight of 214.40 g/mol. Its IUPAC name is 4-N,4-N-dibutylpentane-2,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dibutylpentane-2,4-diamine |
| PubChem CID | 64708414 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 4-N,4-N-dibutylpentane-2,4-diamine |
| SMILES | CCCCN(CCCC)C(C)CC(C)N |
| InChI | InChI=1S/C13H30N2/c1-5-7-9-15(10-8-6-2)13(4)11-12(3)14/h12-13H,5-11,14H2,1-4H3 |
| InChIKey | DVBMQSSFLSJXEK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N,4-N-dibutylpentane-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dibutylpentane-2,4-diamine?
The IUPAC name of 4-N,4-N-dibutylpentane-2,4-diamine (CID 64708414) is 4-N,4-N-dibutylpentane-2,4-diamine.
What is the SMILES notation for 4-N,4-N-dibutylpentane-2,4-diamine?
The canonical SMILES for 4-N,4-N-dibutylpentane-2,4-diamine is CCCCN(CCCC)C(C)CC(C)N.
What is the InChIKey of 4-N,4-N-dibutylpentane-2,4-diamine?
The InChIKey is DVBMQSSFLSJXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2/c1-5-7-9-15(10-8-6-2)13(4)11-12(3)14/h12-13H,5-11,14H2,1-4H3.
What are the key properties of 4-N,4-N-dibutylpentane-2,4-diamine?
4-N,4-N-dibutylpentane-2,4-diamine has a molecular weight of 214.40 g/mol, XLogP of 3.01, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dibutylpentane-2,4-diamine is sourced from PubChem (CID 64708414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).