About N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium
N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium (PubChem CID 87516688) has the molecular formula C37H81N2+
and a molecular weight of 554.07 g/mol. Its IUPAC name is N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium.
Molecular Properties
| Compound Name | N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium |
| PubChem CID | 87516688 |
| Molecular Formula | C37H81N2+ |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.64 |
| IUPAC Name | N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium |
| SMILES | CCCCCCN(CCCCCC)C(C)CCCC.CCCCCC[N+](C)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C19H42N.C18H39N/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-5-8-11-13-16-19(17-14-12-9-6-2)18(4)15-10-7-3/h5-19H2,1-4H3;18H,5-17H2,1-4H3/q+1; |
| InChIKey | RAVKXFBGDLAZAX-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium?
The IUPAC name of N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium (CID 87516688) is N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium.
What is the SMILES notation for N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium?
The canonical SMILES for N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium is CCCCCCN(CCCCCC)C(C)CCCC.CCCCCC[N+](C)(CCCCCC)CCCCCC.
What is the InChIKey of N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium?
The InChIKey is RAVKXFBGDLAZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42N.C18H39N/c1-5-8-11-14-17-20(4,18-15-12-9-6-2)19-16-13-10-7-3;1-5-8-11-13-16-19(17-14-12-9-6-2)18(4)15-10-7-3/h5-19H2,1-4H3;18H,5-17H2,1-4H3/q+1;.
What are the key properties of N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium?
N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium has a molecular weight of 554.07 g/mol, XLogP of 12.20, 29 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-2-yl-N-hexylhexan-1-amine;trihexyl(methyl)azanium is sourced from PubChem (CID 87516688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).