C14H32N2O — CID 63070467
N'-butan-2-yl-N'-butyl-2-ethoxybutane-1,4-diamine (PubChem CID 63070467) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is N'-butan-2-yl-N'-butyl-2-ethoxybutane-1,4-diamine.
| Compound Name | N'-butan-2-yl-N'-butyl-2-ethoxybutane-1,4-diamine |
|---|---|
| PubChem CID | 63070467 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N'-butan-2-yl-N'-butyl-2-ethoxybutane-1,4-diamine |
| SMILES | CCCCN(CCC(CN)OCC)C(C)CC |
| InChI | InChI=1S/C14H32N2O/c1-5-8-10-16(13(4)6-2)11-9-14(12-15)17-7-3/h13-14H,5-12,15H2,1-4H3 |
| InChIKey | ZNDGEKPTJHKGQD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |