About N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine
N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine (PubChem CID 81079886) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine |
| PubChem CID | 81079886 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine |
| SMILES | C=C(C)CN(CC)CCC(CC)CN |
| InChI | InChI=1S/C12H26N2/c1-5-12(9-13)7-8-14(6-2)10-11(3)4/h12H,3,5-10,13H2,1-2,4H3 |
| InChIKey | SCJXKNLGIVLFDT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine?
The IUPAC name of N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine (CID 81079886) is N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine.
What is the SMILES notation for N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine?
The canonical SMILES for N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine is C=C(C)CN(CC)CCC(CC)CN.
What is the InChIKey of N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine?
The InChIKey is SCJXKNLGIVLFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-5-12(9-13)7-8-14(6-2)10-11(3)4/h12H,3,5-10,13H2,1-2,4H3.
What are the key properties of N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine?
N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.26, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-diethyl-N'-(2-methylprop-2-enyl)butane-1,4-diamine is sourced from PubChem (CID 81079886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).