About N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine
N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine (PubChem CID 79470505) has the molecular formula C15H34N2
and a molecular weight of 242.45 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine |
| PubChem CID | 79470505 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CCC(C)CN(CC)CCC(CN)CC(C)C |
| InChI | InChI=1S/C15H34N2/c1-6-14(5)12-17(7-2)9-8-15(11-16)10-13(3)4/h13-15H,6-12,16H2,1-5H3 |
| InChIKey | CGYJLFNENAWAKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine?
The IUPAC name of N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine (CID 79470505) is N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine.
What is the SMILES notation for N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine?
The canonical SMILES for N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine is CCC(C)CN(CC)CCC(CN)CC(C)C.
What is the InChIKey of N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine?
The InChIKey is CGYJLFNENAWAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34N2/c1-6-14(5)12-17(7-2)9-8-15(11-16)10-13(3)4/h13-15H,6-12,16H2,1-5H3.
What are the key properties of N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine?
N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine has a molecular weight of 242.45 g/mol, XLogP of 3.37, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-(2-methylbutyl)-2-(2-methylpropyl)butane-1,4-diamine is sourced from PubChem (CID 79470505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).