C9H20N2O3 — CID 111332663
2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N,N-dimethylacetamide (PubChem CID 111332663) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111332663 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethyl-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(CCOCCO)CC(=O)N(C)C |
| InChI | InChI=1S/C9H20N2O3/c1-10(2)9(13)8-11(3)4-6-14-7-5-12/h12H,4-8H2,1-3H3 |
| InChIKey | VALHSPNVOLQNRZ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|