C11H23NO5 — CID 91261493
N,N-bis[2-(2-hydroxyethoxy)ethyl]propanamide (PubChem CID 91261493) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is N,N-bis[2-(2-hydroxyethoxy)ethyl]propanamide.
| Compound Name | N,N-bis[2-(2-hydroxyethoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 91261493 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N,N-bis[2-(2-hydroxyethoxy)ethyl]propanamide |
| SMILES | CCC(=O)N(CCOCCO)CCOCCO |
| InChI | InChI=1S/C11H23NO5/c1-2-11(15)12(3-7-16-9-5-13)4-8-17-10-6-14/h13-14H,2-10H2,1H3 |
| InChIKey | RCDBNXGNMGGYBE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|