C13H27NO3 — CID 114263827
N-ethyl-N-[2-(2-hydroxyethoxy)ethyl]-4,4-dimethylpentanamide (PubChem CID 114263827) has the molecular formula C13H27NO3 and a molecular weight of 245.36 g/mol. Its IUPAC name is N-ethyl-N-[2-(2-hydroxyethoxy)ethyl]-4,4-dimethylpentanamide.
| Compound Name | N-ethyl-N-[2-(2-hydroxyethoxy)ethyl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 114263827 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | N-ethyl-N-[2-(2-hydroxyethoxy)ethyl]-4,4-dimethylpentanamide |
| SMILES | CCN(CCOCCO)C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C13H27NO3/c1-5-14(8-10-17-11-9-15)12(16)6-7-13(2,3)4/h15H,5-11H2,1-4H3 |
| InChIKey | GLYCJRNREWCSTP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|