C8H16ClNO3 — CID 63307970
4-chloro-N,N-bis(2-hydroxyethyl)butanamide (PubChem CID 63307970) has the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. Its IUPAC name is 4-chloro-N,N-bis(2-hydroxyethyl)butanamide.
| Compound Name | 4-chloro-N,N-bis(2-hydroxyethyl)butanamide |
|---|---|
| PubChem CID | 63307970 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 4-chloro-N,N-bis(2-hydroxyethyl)butanamide |
| SMILES | O=C(CCCCl)N(CCO)CCO |
| InChI | InChI=1S/C8H16ClNO3/c9-3-1-2-8(13)10(4-6-11)5-7-12/h11-12H,1-7H2 |
| InChIKey | UWYZDQYLGIFXRE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|