C10H19NO3 — CID 58150290
N,N-bis(2-hydroxyethyl)hex-5-enamide (PubChem CID 58150290) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)hex-5-enamide.
| Compound Name | N,N-bis(2-hydroxyethyl)hex-5-enamide |
|---|---|
| PubChem CID | 58150290 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)hex-5-enamide |
| SMILES | C=CCCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H19NO3/c1-2-3-4-5-10(14)11(6-8-12)7-9-13/h2,12-13H,1,3-9H2 |
| InChIKey | YNPDHRMKTGATQQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|