About [bis(2-hydroxyethyl)amino] undec-10-enoate
[bis(2-hydroxyethyl)amino] undec-10-enoate (PubChem CID 175063036) has the molecular formula C15H29NO4
and a molecular weight of 287.40 g/mol. Its IUPAC name is [bis(2-hydroxyethyl)amino] undec-10-enoate.
Molecular Properties
| Compound Name | [bis(2-hydroxyethyl)amino] undec-10-enoate |
| PubChem CID | 175063036 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [bis(2-hydroxyethyl)amino] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)ON(CCO)CCO |
| InChI | InChI=1S/C15H29NO4/c1-2-3-4-5-6-7-8-9-10-15(19)20-16(11-13-17)12-14-18/h2,17-18H,1,3-14H2 |
| InChIKey | VMMMPNUXKQJSIU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [bis(2-hydroxyethyl)amino] undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(2-hydroxyethyl)amino] undec-10-enoate?
The IUPAC name of [bis(2-hydroxyethyl)amino] undec-10-enoate (CID 175063036) is [bis(2-hydroxyethyl)amino] undec-10-enoate.
What is the SMILES notation for [bis(2-hydroxyethyl)amino] undec-10-enoate?
The canonical SMILES for [bis(2-hydroxyethyl)amino] undec-10-enoate is C=CCCCCCCCCC(=O)ON(CCO)CCO.
What is the InChIKey of [bis(2-hydroxyethyl)amino] undec-10-enoate?
The InChIKey is VMMMPNUXKQJSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO4/c1-2-3-4-5-6-7-8-9-10-15(19)20-16(11-13-17)12-14-18/h2,17-18H,1,3-14H2.
What are the key properties of [bis(2-hydroxyethyl)amino] undec-10-enoate?
[bis(2-hydroxyethyl)amino] undec-10-enoate has a molecular weight of 287.40 g/mol, XLogP of 2.04, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(2-hydroxyethyl)amino] undec-10-enoate is sourced from PubChem (CID 175063036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).