About 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate
2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate (PubChem CID 140814246) has the molecular formula C36H63NO6
and a molecular weight of 605.90 g/mol. Its IUPAC name is 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate.
Molecular Properties
| Compound Name | 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate |
| PubChem CID | 140814246 |
| Molecular Formula | C36H63NO6 |
| Molecular Weight | 605.90 g/mol |
| Exact Mass | 605.47 |
| IUPAC Name | 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCC=C)CCOC(=O)CCCCCCCC=C |
| InChI | InChI=1S/C36H63NO6/c1-4-7-10-13-16-19-22-25-34(38)41-31-28-37(29-32-42-35(39)26-23-20-17-14-11-8-5-2)30-33-43-36(40)27-24-21-18-15-12-9-6-3/h4-6H,1-3,7-33H2 |
| InChIKey | HPUIILBPSSGODW-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 605.90 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate?
The IUPAC name of 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate (CID 140814246) is 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate.
What is the SMILES notation for 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate?
The canonical SMILES for 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate is C=CCCCCCCCC(=O)OCCN(CCOC(=O)CCCCCCCC=C)CCOC(=O)CCCCCCCC=C.
What is the InChIKey of 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate?
The InChIKey is HPUIILBPSSGODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H63NO6/c1-4-7-10-13-16-19-22-25-34(38)41-31-28-37(29-32-42-35(39)26-23-20-17-14-11-8-5-2)30-33-43-36(40)27-24-21-18-15-12-9-6-3/h4-6H,1-3,7-33H2.
What are the key properties of 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate?
2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate has a molecular weight of 605.90 g/mol, XLogP of 8.67, 33 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-dec-9-enoyloxyethyl)amino]ethyl dec-9-enoate is sourced from PubChem (CID 140814246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).